About 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone
1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone (PubChem CID 121367068) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone.
Molecular Properties
| Compound Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone |
| PubChem CID | 121367068 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone |
| SMILES | O=C(CO)N1CC=CCC1 |
| InChI | InChI=1S/C7H11NO2/c9-6-7(10)8-4-2-1-3-5-8/h1-2,9H,3-6H2 |
| InChIKey | QTUFRBVMRWQCFN-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone?
The IUPAC name of 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone (CID 121367068) is 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone.
What is the SMILES notation for 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone?
The canonical SMILES for 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone is O=C(CO)N1CC=CCC1.
What is the InChIKey of 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone?
The InChIKey is QTUFRBVMRWQCFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c9-6-7(10)8-4-2-1-3-5-8/h1-2,9H,3-6H2.
What are the key properties of 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone?
1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone has a molecular weight of 141.17 g/mol, XLogP of -0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dihydro-2H-pyridin-1-yl)-2-hydroxyethanone is sourced from PubChem (CID 121367068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).