C8H13N3 — CID 121367105
3,4,6,7-tetrahydro-1H-2,7-naphthyridin-2-amine (PubChem CID 121367105) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 3,4,6,7-tetrahydro-1H-2,7-naphthyridin-2-amine.
| Compound Name | 3,4,6,7-tetrahydro-1H-2,7-naphthyridin-2-amine |
|---|---|
| PubChem CID | 121367105 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 3,4,6,7-tetrahydro-1H-2,7-naphthyridin-2-amine |
| SMILES | NN1CCC2=CCNC=C2C1 |
| InChI | InChI=1S/C8H13N3/c9-11-4-2-7-1-3-10-5-8(7)6-11/h1,5,10H,2-4,6,9H2 |
| InChIKey | FNNFUOKJMBOFFA-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|