C19H15F3N4O3 — CID 121367865
(E)-2-(6-methoxy-3-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid (PubChem CID 121367865) has the molecular formula C19H15F3N4O3 and a molecular weight of 404.35 g/mol. Its IUPAC name is (E)-2-(6-methoxy-3-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid.
| Compound Name | (E)-2-(6-methoxy-3-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 121367865 |
| Molecular Formula | C19H15F3N4O3 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | (E)-2-(6-methoxy-3-pyridinyl)-3-[3-[3-methyl-5-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoic acid |
| SMILES | COc1ccc(/C(=C\n2cnc(-c3cc(C)cc(C(F)(F)F)c3)n2)C(=O)O)cn1 |
| InChI | InChI=1S/C19H15F3N4O3/c1-11-5-13(7-14(6-11)19(20,21)22)17-24-10-26(25-17)9-15(18(27)28)12-3-4-16(29-2)23-8-12/h3-10H,1-2H3,(H,27,28)/b15-9+ |
| InChIKey | UBYGZKUGLSAQHO-OQLLNIDSSA-N |
| XLogP | 3.76 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|