About N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide
N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide (PubChem CID 121368080) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide |
| PubChem CID | 121368080 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide |
| SMILES | CCn1[nH]c(=O)c(CNC(=O)C(C)(C)C)c1C |
| InChI | InChI=1S/C12H21N3O2/c1-6-15-8(2)9(10(16)14-15)7-13-11(17)12(3,4)5/h6-7H2,1-5H3,(H,13,17)(H,14,16) |
| InChIKey | QSFWAJQRYWJEBI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide (CID 121368080) is N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide is CCn1[nH]c(=O)c(CNC(=O)C(C)(C)C)c1C.
What is the InChIKey of N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide?
The InChIKey is QSFWAJQRYWJEBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-6-15-8(2)9(10(16)14-15)7-13-11(17)12(3,4)5/h6-7H2,1-5H3,(H,13,17)(H,14,16).
What are the key properties of N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide?
N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide has a molecular weight of 239.32 g/mol, XLogP of 1.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-ethyl-3-methyl-5-oxo-1H-pyrazol-4-yl)methyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 121368080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).