C9H16F3NO — CID 121368328
4-amino-7,7,7-trifluoro-2,2-dimethylheptan-3-one (PubChem CID 121368328) has the molecular formula C9H16F3NO and a molecular weight of 211.23 g/mol. Its IUPAC name is 4-amino-7,7,7-trifluoro-2,2-dimethylheptan-3-one.
| Compound Name | 4-amino-7,7,7-trifluoro-2,2-dimethylheptan-3-one |
|---|---|
| PubChem CID | 121368328 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-amino-7,7,7-trifluoro-2,2-dimethylheptan-3-one |
| SMILES | CC(C)(C)C(=O)C(N)CCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO/c1-8(2,3)7(14)6(13)4-5-9(10,11)12/h6H,4-5,13H2,1-3H3 |
| InChIKey | QXUNEMDCRXEAFF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |