C38H52N2O7 — CID 121368991
methyl (E)-2-[(1R,6R,7S,8aS)-1'-[8-(3,4-dimethoxyphenoxy)octyl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate (PubChem CID 121368991) has the molecular formula C38H52N2O7 and a molecular weight of 648.84 g/mol. Its IUPAC name is methyl (E)-2-[(1R,6R,7S,8aS)-1'-[8-(3,4-dimethoxyphenoxy)octyl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(1R,6R,7S,8aS)-1'-[8-(3,4-dimethoxyphenoxy)octyl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 121368991 |
| Molecular Formula | C38H52N2O7 |
| Molecular Weight | 648.84 g/mol |
| Exact Mass | 648.38 |
| IUPAC Name | methyl (E)-2-[(1R,6R,7S,8aS)-1'-[8-(3,4-dimethoxyphenoxy)octyl]-6-ethyl-2'-oxospiro[3,5,6,7,8,8a-hexahydro-2H-indolizine-1,3'-indole]-7-yl]-3-methoxyprop-2-enoate |
| SMILES | CC[C@H]1CN2CC[C@]3(C(=O)N(CCCCCCCCOc4ccc(OC)c(OC)c4)c4ccccc43)[C@@H]2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C38H52N2O7/c1-6-27-25-39-21-19-38(35(39)24-29(27)30(26-43-2)36(41)46-5)31-15-11-12-16-32(31)40(37(38)42)20-13-9-7-8-10-14-22-47-28-17-18-33(44-3)34(23-28)45-4/h11-12,15-18,23,26-27,29,35H,6-10,13-14,19-22,24-25H2,1-5H3/b30-26+/t27-,29-,35-,38+/m0/s1 |
| InChIKey | PSCJOYBDHJMLEL-JENSDJOUSA-N |
| XLogP | 6.53 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.84 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|