About 6-(2,5-dimethylthiophen-3-yl)hexyl formate
6-(2,5-dimethylthiophen-3-yl)hexyl formate (PubChem CID 121369313) has the molecular formula C13H20O2S
and a molecular weight of 240.37 g/mol. Its IUPAC name is 6-(2,5-dimethylthiophen-3-yl)hexyl formate.
Molecular Properties
| Compound Name | 6-(2,5-dimethylthiophen-3-yl)hexyl formate |
| PubChem CID | 121369313 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 6-(2,5-dimethylthiophen-3-yl)hexyl formate |
| SMILES | Cc1cc(CCCCCCOC=O)c(C)s1 |
| InChI | InChI=1S/C13H20O2S/c1-11-9-13(12(2)16-11)7-5-3-4-6-8-15-10-14/h9-10H,3-8H2,1-2H3 |
| InChIKey | LQZXMJLDIHNHON-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,5-dimethylthiophen-3-yl)hexyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dimethylthiophen-3-yl)hexyl formate?
The IUPAC name of 6-(2,5-dimethylthiophen-3-yl)hexyl formate (CID 121369313) is 6-(2,5-dimethylthiophen-3-yl)hexyl formate.
What is the SMILES notation for 6-(2,5-dimethylthiophen-3-yl)hexyl formate?
The canonical SMILES for 6-(2,5-dimethylthiophen-3-yl)hexyl formate is Cc1cc(CCCCCCOC=O)c(C)s1.
What is the InChIKey of 6-(2,5-dimethylthiophen-3-yl)hexyl formate?
The InChIKey is LQZXMJLDIHNHON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2S/c1-11-9-13(12(2)16-11)7-5-3-4-6-8-15-10-14/h9-10H,3-8H2,1-2H3.
What are the key properties of 6-(2,5-dimethylthiophen-3-yl)hexyl formate?
6-(2,5-dimethylthiophen-3-yl)hexyl formate has a molecular weight of 240.37 g/mol, XLogP of 3.64, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dimethylthiophen-3-yl)hexyl formate is sourced from PubChem (CID 121369313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).