C28H31F3O — CID 121369863
2,3-difluoro-1-[3-fluoro-4-(4-pentylphenyl)phenyl]-4-pentoxybenzene (PubChem CID 121369863) has the molecular formula C28H31F3O and a molecular weight of 440.55 g/mol. Its IUPAC name is 2,3-difluoro-1-[3-fluoro-4-(4-pentylphenyl)phenyl]-4-pentoxybenzene.
| Compound Name | 2,3-difluoro-1-[3-fluoro-4-(4-pentylphenyl)phenyl]-4-pentoxybenzene |
|---|---|
| PubChem CID | 121369863 |
| Molecular Formula | C28H31F3O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2,3-difluoro-1-[3-fluoro-4-(4-pentylphenyl)phenyl]-4-pentoxybenzene |
| SMILES | CCCCCOc1ccc(-c2ccc(-c3ccc(CCCCC)cc3)c(F)c2)c(F)c1F |
| InChI | InChI=1S/C28H31F3O/c1-3-5-7-9-20-10-12-21(13-11-20)23-15-14-22(19-25(23)29)24-16-17-26(28(31)27(24)30)32-18-8-6-4-2/h10-17,19H,3-9,18H2,1-2H3 |
| InChIKey | AZDNCKPGCGTCKC-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|