About 6-methylidene-1,3-diazinan-4-one
6-methylidene-1,3-diazinan-4-one (PubChem CID 121369904) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is 6-methylidene-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | 6-methylidene-1,3-diazinan-4-one |
| PubChem CID | 121369904 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 6-methylidene-1,3-diazinan-4-one |
| SMILES | C=C1CC(=O)NCN1 |
| InChI | InChI=1S/C5H8N2O/c1-4-2-5(8)7-3-6-4/h6H,1-3H2,(H,7,8) |
| InChIKey | NLHRCJIXANKMOG-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methylidene-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidene-1,3-diazinan-4-one?
The IUPAC name of 6-methylidene-1,3-diazinan-4-one (CID 121369904) is 6-methylidene-1,3-diazinan-4-one.
What is the SMILES notation for 6-methylidene-1,3-diazinan-4-one?
The canonical SMILES for 6-methylidene-1,3-diazinan-4-one is C=C1CC(=O)NCN1.
What is the InChIKey of 6-methylidene-1,3-diazinan-4-one?
The InChIKey is NLHRCJIXANKMOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-4-2-5(8)7-3-6-4/h6H,1-3H2,(H,7,8).
What are the key properties of 6-methylidene-1,3-diazinan-4-one?
6-methylidene-1,3-diazinan-4-one has a molecular weight of 112.13 g/mol, XLogP of -0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidene-1,3-diazinan-4-one is sourced from PubChem (CID 121369904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).