C20H10F8N6O4 — CID 121370141
[4-(4-azido-2,3,5,6-tetrafluorobenzoyl)oxycyclohexyl] 4-azido-2,3,5,6-tetrafluorobenzoate (PubChem CID 121370141) has the molecular formula C20H10F8N6O4 and a molecular weight of 550.32 g/mol. Its IUPAC name is [4-(4-azido-2,3,5,6-tetrafluorobenzoyl)oxycyclohexyl] 4-azido-2,3,5,6-tetrafluorobenzoate.
| Compound Name | [4-(4-azido-2,3,5,6-tetrafluorobenzoyl)oxycyclohexyl] 4-azido-2,3,5,6-tetrafluorobenzoate |
|---|---|
| PubChem CID | 121370141 |
| Molecular Formula | C20H10F8N6O4 |
| Molecular Weight | 550.32 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | [4-(4-azido-2,3,5,6-tetrafluorobenzoyl)oxycyclohexyl] 4-azido-2,3,5,6-tetrafluorobenzoate |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(C(=O)OC2CCC(OC(=O)c3c(F)c(F)c(N=[N+]=[N-])c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C20H10F8N6O4/c21-9-7(10(22)14(26)17(13(9)25)31-33-29)19(35)37-5-1-2-6(4-3-5)38-20(36)8-11(23)15(27)18(32-34-30)16(28)12(8)24/h5-6H,1-4H2 |
| InChIKey | UMVDYLDOZVGLMN-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 150.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.32 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|