C44H59NO6 — CID 121370181
1,3,5-tris[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]piperidine-2,4,6-trione (PubChem CID 121370181) has the molecular formula C44H59NO6 and a molecular weight of 697.96 g/mol. Its IUPAC name is 1,3,5-tris[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]piperidine-2,4,6-trione.
| Compound Name | 1,3,5-tris[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]piperidine-2,4,6-trione |
|---|---|
| PubChem CID | 121370181 |
| Molecular Formula | C44H59NO6 |
| Molecular Weight | 697.96 g/mol |
| Exact Mass | 697.43 |
| IUPAC Name | 1,3,5-tris[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]piperidine-2,4,6-trione |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1CC1C(=O)C(Cc2c(C)cc(C(C)(C)C)c(O)c2C)C(=O)N(Cc2c(C)cc(C(C)(C)C)c(O)c2C)C1=O |
| InChI | InChI=1S/C44H59NO6/c1-22-16-33(42(7,8)9)36(46)25(4)28(22)19-30-39(49)31(20-29-23(2)17-34(43(10,11)12)37(47)26(29)5)41(51)45(40(30)50)21-32-24(3)18-35(44(13,14)15)38(48)27(32)6/h16-18,30-31,46-48H,19-21H2,1-15H3 |
| InChIKey | DPSPSFHXGGHFRL-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.96 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|