About 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate
2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate (PubChem CID 121370961) has the molecular formula C15H20F2O5
and a molecular weight of 318.32 g/mol. Its IUPAC name is 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate.
Molecular Properties
| Compound Name | 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate |
| PubChem CID | 121370961 |
| Molecular Formula | C15H20F2O5 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OCCOC1C2CC3CC(C2)C(=O)OC1C3 |
| InChI | InChI=1S/C15H20F2O5/c1-15(16,17)14(19)21-3-2-20-12-9-4-8-5-10(7-9)13(18)22-11(12)6-8/h8-12H,2-7H2,1H3 |
| InChIKey | JBGPQTYVWPAHQL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate?
The IUPAC name of 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate (CID 121370961) is 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate.
What is the SMILES notation for 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate?
The canonical SMILES for 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate is CC(F)(F)C(=O)OCCOC1C2CC3CC(C2)C(=O)OC1C3.
What is the InChIKey of 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate?
The InChIKey is JBGPQTYVWPAHQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2O5/c1-15(16,17)14(19)21-3-2-20-12-9-4-8-5-10(7-9)13(18)22-11(12)6-8/h8-12H,2-7H2,1H3.
What are the key properties of 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate?
2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate has a molecular weight of 318.32 g/mol, XLogP of 1.93, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]ethyl 2,2-difluoropropanoate is sourced from PubChem (CID 121370961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).