C35H9F4N7 — CID 121371736
3-(dicyanomethylidene)-2-[9-(dicyanomethylidene)-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]indene-1,5-dicarbonitrile (PubChem CID 121371736) has the molecular formula C35H9F4N7 and a molecular weight of 603.50 g/mol. Its IUPAC name is 3-(dicyanomethylidene)-2-[9-(dicyanomethylidene)-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]indene-1,5-dicarbonitrile.
| Compound Name | 3-(dicyanomethylidene)-2-[9-(dicyanomethylidene)-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]indene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 121371736 |
| Molecular Formula | C35H9F4N7 |
| Molecular Weight | 603.50 g/mol |
| Exact Mass | 603.09 |
| IUPAC Name | 3-(dicyanomethylidene)-2-[9-(dicyanomethylidene)-7-(3,4,5,6-tetrafluoro-2-pyridinyl)fluoren-2-yl]indene-1,5-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc3c(c2)C(=C(C#N)C#N)c2cc(-c4nc(F)c(F)c(F)c4F)ccc2-3)=C(C#N)c2ccc(C#N)cc21 |
| InChI | InChI=1S/C35H9F4N7/c36-31-32(37)34(46-35(39)33(31)38)18-3-6-22-21-5-2-17(8-25(21)28(26(22)9-18)19(11-41)12-42)29-27(15-45)23-4-1-16(10-40)7-24(23)30(29)20(13-43)14-44/h1-9H |
| InChIKey | IRIGEIVVONYCAO-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 155.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.50 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|