C25H17N5O2 — CID 121371773
4-(2-pyridin-4-ylimidazo[4,5-f][1,10]phenanthrolin-3-yl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 121371773) has the molecular formula C25H17N5O2 and a molecular weight of 419.44 g/mol. Its IUPAC name is 4-(2-pyridin-4-ylimidazo[4,5-f][1,10]phenanthrolin-3-yl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 4-(2-pyridin-4-ylimidazo[4,5-f][1,10]phenanthrolin-3-yl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 121371773 |
| Molecular Formula | C25H17N5O2 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 4-(2-pyridin-4-ylimidazo[4,5-f][1,10]phenanthrolin-3-yl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C=CC(n2c(-c3ccncc3)nc3c4cccnc4c4ncccc4c32)=CC1 |
| InChI | InChI=1S/C25H17N5O2/c31-25(32)16-5-7-17(8-6-16)30-23-19-4-2-12-28-21(19)20-18(3-1-11-27-20)22(23)29-24(30)15-9-13-26-14-10-15/h1-5,7-14,16H,6H2,(H,31,32) |
| InChIKey | DHCAFGZEZBRXFV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|