About 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane
3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane (PubChem CID 121371775) has the molecular formula C11H20F4
and a molecular weight of 228.27 g/mol. Its IUPAC name is 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane.
Molecular Properties
| Compound Name | 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane |
| PubChem CID | 121371775 |
| Molecular Formula | C11H20F4 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane |
| SMILES | CCC(C)(C)CC(F)(C(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H20F4/c1-6-9(4,5)7-10(12,8(2)3)11(13,14)15/h8H,6-7H2,1-5H3 |
| InChIKey | LKQNJHDXRLSWHX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane?
The IUPAC name of 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane (CID 121371775) is 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane.
What is the SMILES notation for 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane?
The canonical SMILES for 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane is CCC(C)(C)CC(F)(C(C)C)C(F)(F)F.
What is the InChIKey of 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane?
The InChIKey is LKQNJHDXRLSWHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F4/c1-6-9(4,5)7-10(12,8(2)3)11(13,14)15/h8H,6-7H2,1-5H3.
What are the key properties of 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane?
3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane has a molecular weight of 228.27 g/mol, XLogP of 4.74, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,5,5-trimethyl-3-(trifluoromethyl)heptane is sourced from PubChem (CID 121371775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).