C41H39ClN3O3S+ — CID 121371922
(4-chloro-2,6-dimethylphenyl)-[9-[2-(cyanomethylsulfonyl)phenyl]-6-(N-ethyl-2,6-dimethylanilino)xanthen-3-ylidene]-ethylazanium (PubChem CID 121371922) has the molecular formula C41H39ClN3O3S+ and a molecular weight of 689.30 g/mol. Its IUPAC name is (4-chloro-2,6-dimethylphenyl)-[9-[2-(cyanomethylsulfonyl)phenyl]-6-(N-ethyl-2,6-dimethylanilino)xanthen-3-ylidene]-ethylazanium.
| Compound Name | (4-chloro-2,6-dimethylphenyl)-[9-[2-(cyanomethylsulfonyl)phenyl]-6-(N-ethyl-2,6-dimethylanilino)xanthen-3-ylidene]-ethylazanium |
|---|---|
| PubChem CID | 121371922 |
| Molecular Formula | C41H39ClN3O3S+ |
| Molecular Weight | 689.30 g/mol |
| Exact Mass | 688.24 |
| IUPAC Name | (4-chloro-2,6-dimethylphenyl)-[9-[2-(cyanomethylsulfonyl)phenyl]-6-(N-ethyl-2,6-dimethylanilino)xanthen-3-ylidene]-ethylazanium |
| SMILES | CCN(c1ccc2c(-c3ccccc3S(=O)(=O)CC#N)c3cc/c(=[N+](/CC)c4c(C)cc(Cl)cc4C)cc-3oc2c1)c1c(C)cccc1C |
| InChI | InChI=1S/C41H39ClN3O3S/c1-7-44(40-26(3)12-11-13-27(40)4)31-16-18-33-36(24-31)48-37-25-32(45(8-2)41-28(5)22-30(42)23-29(41)6)17-19-34(37)39(33)35-14-9-10-15-38(35)49(46,47)21-20-43/h9-19,22-25H,7-8,21H2,1-6H3/q+1 |
| InChIKey | UTLICTDDGXJNPL-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.30 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|