C28H38N8O2S2 — CID 121371926
N-methyl-N-[2-[2-[2-[N-methyl-4-[(3-methyl-2H-1,3-thiazol-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethyl]-4-[(3-methyl-2H-1,3-thiazol-2-yl)diazenyl]aniline (PubChem CID 121371926) has the molecular formula C28H38N8O2S2 and a molecular weight of 582.80 g/mol. Its IUPAC name is N-methyl-N-[2-[2-[2-[N-methyl-4-[(3-methyl-2H-1,3-thiazol-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethyl]-4-[(3-methyl-2H-1,3-thiazol-2-yl)diazenyl]aniline.
| Compound Name | N-methyl-N-[2-[2-[2-[N-methyl-4-[(3-methyl-2H-1,3-thiazol-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethyl]-4-[(3-methyl-2H-1,3-thiazol-2-yl)diazenyl]aniline |
|---|---|
| PubChem CID | 121371926 |
| Molecular Formula | C28H38N8O2S2 |
| Molecular Weight | 582.80 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | N-methyl-N-[2-[2-[2-[N-methyl-4-[(3-methyl-2H-1,3-thiazol-2-yl)diazenyl]anilino]ethoxy]ethoxy]ethyl]-4-[(3-methyl-2H-1,3-thiazol-2-yl)diazenyl]aniline |
| SMILES | CN(CCOCCOCCN(C)c1ccc(/N=N/C2SC=CN2C)cc1)c1ccc(/N=N/C2SC=CN2C)cc1 |
| InChI | InChI=1S/C28H38N8O2S2/c1-33(25-9-5-23(6-10-25)29-31-27-35(3)15-21-39-27)13-17-37-19-20-38-18-14-34(2)26-11-7-24(8-12-26)30-32-28-36(4)16-22-40-28/h5-12,15-16,21-22,27-28H,13-14,17-20H2,1-4H3/b31-29+,32-30+ |
| InChIKey | RLCJPRZIANQGOC-JWTBXLROSA-N |
| XLogP | 6.33 |
| TPSA | 80.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.80 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|