C14H15BrFNO4 — CID 121372361
(4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(hydroxymethyl)-1,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]oxazin-2-one (PubChem CID 121372361) has the molecular formula C14H15BrFNO4 and a molecular weight of 360.18 g/mol. Its IUPAC name is (4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(hydroxymethyl)-1,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]oxazin-2-one.
| Compound Name | (4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(hydroxymethyl)-1,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 121372361 |
| Molecular Formula | C14H15BrFNO4 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | (4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(hydroxymethyl)-1,4,4a,5,6,8-hexahydropyrano[3,4-d][1,3]oxazin-2-one |
| SMILES | O=C1N[C@@]2(c3cc(Br)ccc3F)CO[C@@H](CO)C[C@H]2CO1 |
| InChI | InChI=1S/C14H15BrFNO4/c15-9-1-2-12(16)11(4-9)14-7-21-10(5-18)3-8(14)6-20-13(19)17-14/h1-2,4,8,10,18H,3,5-7H2,(H,17,19)/t8-,10+,14-/m0/s1 |
| InChIKey | FSKPFTVUJDHFRE-HNXYLICVSA-N |
| XLogP | 1.92 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |