C51H42N2O2S — CID 121373513
(E)-2-cyano-3-[5-[(E)-2-[4-[(2,4-dimethylphenyl)-[4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]phenyl]methyl]phenyl]ethenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 121373513) has the molecular formula C51H42N2O2S and a molecular weight of 746.98 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[(E)-2-[4-[(2,4-dimethylphenyl)-[4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]phenyl]methyl]phenyl]ethenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[(E)-2-[4-[(2,4-dimethylphenyl)-[4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]phenyl]methyl]phenyl]ethenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 121373513 |
| Molecular Formula | C51H42N2O2S |
| Molecular Weight | 746.98 g/mol |
| Exact Mass | 746.30 |
| IUPAC Name | (E)-2-cyano-3-[5-[(E)-2-[4-[(2,4-dimethylphenyl)-[4-[4-(N-(2,4-dimethylphenyl)anilino)phenyl]phenyl]methyl]phenyl]ethenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | Cc1ccc(C(c2ccc(/C=C/c3ccc(/C=C(\C#N)C(=O)O)s3)cc2)c2ccc(-c3ccc(N(c4ccccc4)c4ccc(C)cc4C)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C51H42N2O2S/c1-34-10-28-48(36(3)30-34)50(41-15-12-38(13-16-41)14-25-46-26-27-47(56-46)32-43(33-52)51(54)55)42-19-17-39(18-20-42)40-21-23-45(24-22-40)53(44-8-6-5-7-9-44)49-29-11-35(2)31-37(49)4/h5-32,50H,1-4H3,(H,54,55)/b25-14+,43-32+ |
| InChIKey | YCRMCEVKXQMBDO-WUAKVAMDSA-N |
| XLogP | 13.46 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.98 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|