C37H20F3NO4S — CID 121373755
[6-[N-(15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-2-yl)anilino]pyren-1-yl] trifluoromethanesulfonate (PubChem CID 121373755) has the molecular formula C37H20F3NO4S and a molecular weight of 631.63 g/mol. Its IUPAC name is [6-[N-(15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-2-yl)anilino]pyren-1-yl] trifluoromethanesulfonate.
| Compound Name | [6-[N-(15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-2-yl)anilino]pyren-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 121373755 |
| Molecular Formula | C37H20F3NO4S |
| Molecular Weight | 631.63 g/mol |
| Exact Mass | 631.11 |
| IUPAC Name | [6-[N-(15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),6,8(13),9,11-heptaen-2-yl)anilino]pyren-1-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2ccc3c(N(c4ccccc4)c4ccc5ccc6cccc7oc4c5c67)ccc4ccc1c2c43)C(F)(F)F |
| InChI | InChI=1S/C37H20F3NO4S/c38-37(39,40)46(42,43)45-30-20-15-23-11-16-26-28(18-13-22-12-17-27(30)33(23)32(22)26)41(25-6-2-1-3-7-25)29-19-14-24-10-9-21-5-4-8-31-34(21)35(24)36(29)44-31/h1-20H |
| InChIKey | PCQADOILWNSYCE-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.63 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|