C23H24N2O3 — CID 121373934
(2E,4E,6Z,8E)-7-(4-methoxyphenyl)-3-methyl-9-(4-nitrophenyl)nona-2,4,6,8-tetraen-1-amine (PubChem CID 121373934) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-7-(4-methoxyphenyl)-3-methyl-9-(4-nitrophenyl)nona-2,4,6,8-tetraen-1-amine.
| Compound Name | (2E,4E,6Z,8E)-7-(4-methoxyphenyl)-3-methyl-9-(4-nitrophenyl)nona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 121373934 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (2E,4E,6Z,8E)-7-(4-methoxyphenyl)-3-methyl-9-(4-nitrophenyl)nona-2,4,6,8-tetraen-1-amine |
| SMILES | COc1ccc(C(=C\C=C\C(C)=C\CN)/C=C/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-18(16-17-24)4-3-5-20(21-10-14-23(28-2)15-11-21)9-6-19-7-12-22(13-8-19)25(26)27/h3-16H,17,24H2,1-2H3/b4-3+,9-6+,18-16+,20-5- |
| InChIKey | SFZLCLSXCANCPG-XDBUWWOUSA-N |
| XLogP | 5.16 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|