C20H31N — CID 121373966
(2E,4E,6Z,8E)-7-tert-butyl-9-(cyclohexen-1-yl)-3-methylnona-2,4,6,8-tetraen-1-amine (PubChem CID 121373966) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-7-tert-butyl-9-(cyclohexen-1-yl)-3-methylnona-2,4,6,8-tetraen-1-amine.
| Compound Name | (2E,4E,6Z,8E)-7-tert-butyl-9-(cyclohexen-1-yl)-3-methylnona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 121373966 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | (2E,4E,6Z,8E)-7-tert-butyl-9-(cyclohexen-1-yl)-3-methylnona-2,4,6,8-tetraen-1-amine |
| SMILES | CC(/C=C/C=C(/C=C/C1=CCCCC1)C(C)(C)C)=C\CN |
| InChI | InChI=1S/C20H31N/c1-17(15-16-21)9-8-12-19(20(2,3)4)14-13-18-10-6-5-7-11-18/h8-10,12-15H,5-7,11,16,21H2,1-4H3/b9-8+,14-13+,17-15+,19-12- |
| InChIKey | UVFKKLFIZNNYKX-UEEQSSBOSA-N |
| XLogP | 5.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|