C26H43N — CID 121373971
(2Z,4E,6Z,8E)-3,7-ditert-butyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine (PubChem CID 121373971) has the molecular formula C26H43N and a molecular weight of 369.64 g/mol. Its IUPAC name is (2Z,4E,6Z,8E)-3,7-ditert-butyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine.
| Compound Name | (2Z,4E,6Z,8E)-3,7-ditert-butyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 121373971 |
| Molecular Formula | C26H43N |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 369.34 |
| IUPAC Name | (2Z,4E,6Z,8E)-3,7-ditert-butyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
| SMILES | CC1=C(/C=C/C(=C/C=C/C(=C/CN)C(C)(C)C)C(C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H43N/c1-20-12-11-18-26(8,9)23(20)16-15-21(24(2,3)4)13-10-14-22(17-19-27)25(5,6)7/h10,13-17H,11-12,18-19,27H2,1-9H3/b14-10+,16-15+,21-13-,22-17- |
| InChIKey | WWFMBBPWAFXMFU-PQOCCUSGSA-N |
| XLogP | 7.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|