C21H33N — CID 121373973
(2E,4E,6Z,8E)-7-tert-butyl-3-methyl-9-(2-methylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine (PubChem CID 121373973) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-7-tert-butyl-3-methyl-9-(2-methylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine.
| Compound Name | (2E,4E,6Z,8E)-7-tert-butyl-3-methyl-9-(2-methylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 121373973 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | (2E,4E,6Z,8E)-7-tert-butyl-3-methyl-9-(2-methylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
| SMILES | CC1=C(/C=C/C(=C/C=C/C(C)=C/CN)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C21H33N/c1-17(15-16-22)9-8-12-20(21(3,4)5)14-13-19-11-7-6-10-18(19)2/h8-9,12-15H,6-7,10-11,16,22H2,1-5H3/b9-8+,14-13+,17-15+,20-12- |
| InChIKey | ZMPWBAAIKGRDMR-SSIZDBQQSA-N |
| XLogP | 5.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|