C23H37N — CID 121373974
(2Z,4E,6Z,8E)-3,7-ditert-butyl-9-(cyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine (PubChem CID 121373974) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is (2Z,4E,6Z,8E)-3,7-ditert-butyl-9-(cyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine.
| Compound Name | (2Z,4E,6Z,8E)-3,7-ditert-butyl-9-(cyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 121373974 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | (2Z,4E,6Z,8E)-3,7-ditert-butyl-9-(cyclohexen-1-yl)nona-2,4,6,8-tetraen-1-amine |
| SMILES | CC(C)(C)C(=C\CN)/C=C/C=C(/C=C/C1=CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C23H37N/c1-22(2,3)20(16-15-19-11-8-7-9-12-19)13-10-14-21(17-18-24)23(4,5)6/h10-11,13-17H,7-9,12,18,24H2,1-6H3/b14-10+,16-15+,20-13-,21-17- |
| InChIKey | JFDYLHJISQUDRN-JBMZXOPVSA-N |
| XLogP | 6.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|