C25H43O4S- — CID 121373978
(3R)-3-[(3R,6R,7R,8R,9S,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butane-1-sulfinate (PubChem CID 121373978) has the molecular formula C25H43O4S- and a molecular weight of 439.68 g/mol. Its IUPAC name is (3R)-3-[(3R,6R,7R,8R,9S,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butane-1-sulfinate.
| Compound Name | (3R)-3-[(3R,6R,7R,8R,9S,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butane-1-sulfinate |
|---|---|
| PubChem CID | 121373978 |
| Molecular Formula | C25H43O4S- |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | (3R)-3-[(3R,6R,7R,8R,9S,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butane-1-sulfinate |
| SMILES | CC[C@@H]1C2C[C@H](O)CCC2(C)[C@H]2CCC3(C)[C@@H]([C@H](C)CCS(=O)[O-])CC[C@H]3[C@H]2[C@@H]1O |
| InChI | InChI=1S/C25H44O4S/c1-5-17-21-14-16(26)8-11-25(21,4)20-9-12-24(3)18(15(2)10-13-30(28)29)6-7-19(24)22(20)23(17)27/h15-23,26-27H,5-14H2,1-4H3,(H,28,29)/p-1/t15-,16-,17-,18-,19+,20+,21?,22-,23-,24?,25?/m1/s1 |
| InChIKey | WEGZUHNBBGREES-GKTHFZDFSA-M |
| XLogP | 4.52 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|