C20H33N — CID 121373982
(2E,4Z,6E)-5-tert-butyl-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-2,4,6-trien-1-amine (PubChem CID 121373982) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is (2E,4Z,6E)-5-tert-butyl-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z,6E)-5-tert-butyl-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 121373982 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | (2E,4Z,6E)-5-tert-butyl-7-(2,6,6-trimethylcyclohexen-1-yl)hepta-2,4,6-trien-1-amine |
| SMILES | CC1=C(/C=C/C(=C/C=C/CN)C(C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H33N/c1-16-10-9-14-20(5,6)18(16)13-12-17(19(2,3)4)11-7-8-15-21/h7-8,11-13H,9-10,14-15,21H2,1-6H3/b8-7+,13-12+,17-11- |
| InChIKey | CZBAJYZUMSJBDD-JLUVVWDZSA-N |
| XLogP | 5.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|