C23H23N5O2 — CID 121374925
1-[3-ethyl-2-[(6-methyl-5-phenyl-2-pyridinyl)oxymethyl]phenyl]-4-methyltetrazol-5-one (PubChem CID 121374925) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-[3-ethyl-2-[(6-methyl-5-phenyl-2-pyridinyl)oxymethyl]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[3-ethyl-2-[(6-methyl-5-phenyl-2-pyridinyl)oxymethyl]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 121374925 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-[3-ethyl-2-[(6-methyl-5-phenyl-2-pyridinyl)oxymethyl]phenyl]-4-methyltetrazol-5-one |
| SMILES | CCc1cccc(-n2nnn(C)c2=O)c1COc1ccc(-c2ccccc2)c(C)n1 |
| InChI | InChI=1S/C23H23N5O2/c1-4-17-11-8-12-21(28-23(29)27(3)25-26-28)20(17)15-30-22-14-13-19(16(2)24-22)18-9-6-5-7-10-18/h5-14H,4,15H2,1-3H3 |
| InChIKey | SIMUJIXBTLXEQT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |