C23H18ClN3O4S — CID 121375323
2-amino-2-[5-[5-(3-chloro-4-thiophen-3-ylphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]propane-1,1-diol (PubChem CID 121375323) has the molecular formula C23H18ClN3O4S and a molecular weight of 467.93 g/mol. Its IUPAC name is 2-amino-2-[5-[5-(3-chloro-4-thiophen-3-ylphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]propane-1,1-diol.
| Compound Name | 2-amino-2-[5-[5-(3-chloro-4-thiophen-3-ylphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]propane-1,1-diol |
|---|---|
| PubChem CID | 121375323 |
| Molecular Formula | C23H18ClN3O4S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 2-amino-2-[5-[5-(3-chloro-4-thiophen-3-ylphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]propane-1,1-diol |
| SMILES | CC(N)(c1cc2cc(-c3noc(-c4ccc(-c5ccsc5)c(Cl)c4)n3)ccc2o1)C(O)O |
| InChI | InChI=1S/C23H18ClN3O4S/c1-23(25,22(28)29)19-10-15-8-12(3-5-18(15)30-19)20-26-21(31-27-20)13-2-4-16(17(24)9-13)14-6-7-32-11-14/h2-11,22,28-29H,25H2,1H3 |
| InChIKey | FRAGJVKMCNREDF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|