C9H15N — CID 121376503
3,3-bis(ethenyl)piperidine (PubChem CID 121376503) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 3,3-bis(ethenyl)piperidine.
| Compound Name | 3,3-bis(ethenyl)piperidine |
|---|---|
| PubChem CID | 121376503 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 3,3-bis(ethenyl)piperidine |
| SMILES | C=CC1(C=C)CCCNC1 |
| InChI | InChI=1S/C9H15N/c1-3-9(4-2)6-5-7-10-8-9/h3-4,10H,1-2,5-8H2 |
| InChIKey | BSKRYENMROLFCG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|