About 3,5-bis(ethenyl)morpholine
3,5-bis(ethenyl)morpholine (PubChem CID 121376543) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 3,5-bis(ethenyl)morpholine.
Molecular Properties
| Compound Name | 3,5-bis(ethenyl)morpholine |
| PubChem CID | 121376543 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 3,5-bis(ethenyl)morpholine |
| SMILES | C=CC1COCC(C=C)N1 |
| InChI | InChI=1S/C8H13NO/c1-3-7-5-10-6-8(4-2)9-7/h3-4,7-9H,1-2,5-6H2 |
| InChIKey | SHIFUTPMTZENPV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(ethenyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(ethenyl)morpholine?
The IUPAC name of 3,5-bis(ethenyl)morpholine (CID 121376543) is 3,5-bis(ethenyl)morpholine.
What is the SMILES notation for 3,5-bis(ethenyl)morpholine?
The canonical SMILES for 3,5-bis(ethenyl)morpholine is C=CC1COCC(C=C)N1.
What is the InChIKey of 3,5-bis(ethenyl)morpholine?
The InChIKey is SHIFUTPMTZENPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-3-7-5-10-6-8(4-2)9-7/h3-4,7-9H,1-2,5-6H2.
What are the key properties of 3,5-bis(ethenyl)morpholine?
3,5-bis(ethenyl)morpholine has a molecular weight of 139.20 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(ethenyl)morpholine is sourced from PubChem (CID 121376543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).