C24H48O6 — CID 121376570
10-(2-ethylhexoxy)-10-oxodecanoic acid;hexane-1,6-diol (PubChem CID 121376570) has the molecular formula C24H48O6 and a molecular weight of 432.64 g/mol. Its IUPAC name is 10-(2-ethylhexoxy)-10-oxodecanoic acid;hexane-1,6-diol.
| Compound Name | 10-(2-ethylhexoxy)-10-oxodecanoic acid;hexane-1,6-diol |
|---|---|
| PubChem CID | 121376570 |
| Molecular Formula | C24H48O6 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | 10-(2-ethylhexoxy)-10-oxodecanoic acid;hexane-1,6-diol |
| SMILES | CCCCC(CC)COC(=O)CCCCCCCCC(=O)O.OCCCCCCO |
| InChI | InChI=1S/C18H34O4.C6H14O2/c1-3-5-12-16(4-2)15-22-18(21)14-11-9-7-6-8-10-13-17(19)20;7-5-3-1-2-4-6-8/h16H,3-15H2,1-2H3,(H,19,20);7-8H,1-6H2 |
| InChIKey | MTSMXPYRIKDHMB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|