C16H22N2O6 — CID 121377522
6-[(2R,5R)-2,5-dimethoxy-2-methylpyrrolidine-1-carbonyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-8-carboxylic acid (PubChem CID 121377522) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is 6-[(2R,5R)-2,5-dimethoxy-2-methylpyrrolidine-1-carbonyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-8-carboxylic acid.
| Compound Name | 6-[(2R,5R)-2,5-dimethoxy-2-methylpyrrolidine-1-carbonyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-8-carboxylic acid |
|---|---|
| PubChem CID | 121377522 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 6-[(2R,5R)-2,5-dimethoxy-2-methylpyrrolidine-1-carbonyl]-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-8-carboxylic acid |
| SMILES | CO[C@@H]1CC[C@@](C)(OC)N1C(=O)c1cc(C(=O)O)c2n1CCOC2 |
| InChI | InChI=1S/C16H22N2O6/c1-16(23-3)5-4-13(22-2)18(16)14(19)11-8-10(15(20)21)12-9-24-7-6-17(11)12/h8,13H,4-7,9H2,1-3H3,(H,20,21)/t13-,16-/m1/s1 |
| InChIKey | UUIVFMLKFMEIJU-CZUORRHYSA-N |
| XLogP | 1.29 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |