About 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide
1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide (PubChem CID 121377574) has the molecular formula C27H17BrO3S
and a molecular weight of 501.40 g/mol. Its IUPAC name is 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide.
Molecular Properties
| Compound Name | 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide |
| PubChem CID | 121377574 |
| Molecular Formula | C27H17BrO3S |
| Molecular Weight | 501.40 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide |
| SMILES | O=C1c2ccccc2C(=O)c2c(Br)cccc21.O=S1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C14H7BrO2.C13H10OS/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16;14-15-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15/h1-7H;1-8H,9H2 |
| InChIKey | JSQFGJBTNBHMHO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.40 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide?
The IUPAC name of 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide (CID 121377574) is 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide.
What is the SMILES notation for 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide?
The canonical SMILES for 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide is O=C1c2ccccc2C(=O)c2c(Br)cccc21.O=S1c2ccccc2Cc2ccccc21.
What is the InChIKey of 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide?
The InChIKey is JSQFGJBTNBHMHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7BrO2.C13H10OS/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16;14-15-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15/h1-7H;1-8H,9H2.
What are the key properties of 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide?
1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide has a molecular weight of 501.40 g/mol, XLogP of 5.98, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoanthracene-9,10-dione;9H-thioxanthene 10-oxide is sourced from PubChem (CID 121377574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).