C31H40ClFN6O5 — CID 121377794
tert-butyl 4-[2-[3-[[(2S,3R)-2-azido-3-(4-chlorophenyl)-3-(oxan-4-yl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 121377794) has the molecular formula C31H40ClFN6O5 and a molecular weight of 631.15 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-[[(2S,3R)-2-azido-3-(4-chlorophenyl)-3-(oxan-4-yl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-[[(2S,3R)-2-azido-3-(4-chlorophenyl)-3-(oxan-4-yl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 121377794 |
| Molecular Formula | C31H40ClFN6O5 |
| Molecular Weight | 631.15 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | tert-butyl 4-[2-[3-[[(2S,3R)-2-azido-3-(4-chlorophenyl)-3-(oxan-4-yl)propanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(CCc2c(F)cncc2NC(=O)[C@@H](N=[N+]=[N-])[C@@H](c2ccc(Cl)cc2)C2CCOCC2)COC1(C)C |
| InChI | InChI=1S/C31H40ClFN6O5/c1-30(2,3)44-29(41)39-22(18-43-31(39,4)5)10-11-23-24(33)16-35-17-25(23)36-28(40)27(37-38-34)26(20-12-14-42-15-13-20)19-6-8-21(32)9-7-19/h6-9,16-17,20,22,26-27H,10-15,18H2,1-5H3,(H,36,40)/t22?,26-,27-/m0/s1 |
| InChIKey | ZBZNSXGANOJWKX-ILRLXPBVSA-N |
| XLogP | 7.01 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.15 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|