C35H33F3N6O5S — CID 121377961
4-(benzenesulfonyl)-3-[2-[2-[[3,3-bis(3-fluorophenyl)-2-(iminoazaniumylideneamino)propanoyl]amino]-6-fluorophenyl]ethyl]-5-methylpiperazine-1-carboxylate (PubChem CID 121377961) has the molecular formula C35H33F3N6O5S and a molecular weight of 706.75 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-3-[2-[2-[[3,3-bis(3-fluorophenyl)-2-(iminoazaniumylideneamino)propanoyl]amino]-6-fluorophenyl]ethyl]-5-methylpiperazine-1-carboxylate.
| Compound Name | 4-(benzenesulfonyl)-3-[2-[2-[[3,3-bis(3-fluorophenyl)-2-(iminoazaniumylideneamino)propanoyl]amino]-6-fluorophenyl]ethyl]-5-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 121377961 |
| Molecular Formula | C35H33F3N6O5S |
| Molecular Weight | 706.75 g/mol |
| Exact Mass | 706.22 |
| IUPAC Name | 4-(benzenesulfonyl)-3-[2-[2-[[3,3-bis(3-fluorophenyl)-2-(iminoazaniumylideneamino)propanoyl]amino]-6-fluorophenyl]ethyl]-5-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(C(=O)[O-])CC(CCc2c(F)cccc2NC(=O)C(N=[N+]=N)C(c2cccc(F)c2)c2cccc(F)c2)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H33F3N6O5S/c1-22-20-43(35(46)47)21-27(44(22)50(48,49)28-12-3-2-4-13-28)16-17-29-30(38)14-7-15-31(29)40-34(45)33(41-42-39)32(23-8-5-10-25(36)18-23)24-9-6-11-26(37)19-24/h2-15,18-19,22,27,32-33,39H,16-17,20-21H2,1H3,(H-,40,45,46,47) |
| InChIKey | VYNUZPUFRFFZHQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 160.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.75 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|