About US10087148, Example 10
US10087148, Example 10 (PubChem CID 121378086) has the molecular formula C28H25N5O2S
and a molecular weight of 495.60 g/mol. Its IUPAC name is N-[4-[4-[(2-phenyl-2-pyridin-4-ylethyl)amino]quinazolin-2-yl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | US10087148, Example 10 |
| PubChem CID | 121378086 |
| Molecular Formula | C28H25N5O2S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N-[4-[4-[(2-phenyl-2-pyridin-4-ylethyl)amino]quinazolin-2-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=N2)NCC(C4=CC=CC=C4)C5=CC=NC=C5 |
| InChI | InChI=1S/C28H25N5O2S/c1-36(34,35)33-23-13-11-22(12-14-23)27-31-26-10-6-5-9-24(26)28(32-27)30-19-25(20-7-3-2-4-8-20)21-15-17-29-18-16-21/h2-18,25,33H,19H2,1H3,(H,30,31,32) |
| InChIKey | UEIGDVJRFIBOPR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 105.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | 769 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze US10087148, Example 10 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10087148, Example 10?
The IUPAC name of US10087148, Example 10 (CID 121378086) is N-[4-[4-[(2-phenyl-2-pyridin-4-ylethyl)amino]quinazolin-2-yl]phenyl]methanesulfonamide.
What is the SMILES notation for US10087148, Example 10?
The canonical SMILES for US10087148, Example 10 is CS(=O)(=O)NC1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=N2)NCC(C4=CC=CC=C4)C5=CC=NC=C5.
What is the InChIKey of US10087148, Example 10?
The InChIKey is UEIGDVJRFIBOPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25N5O2S/c1-36(34,35)33-23-13-11-22(12-14-23)27-31-26-10-6-5-9-24(26)28(32-27)30-19-25(20-7-3-2-4-8-20)21-15-17-29-18-16-21/h2-18,25,33H,19H2,1H3,(H,30,31,32).
What are the key properties of US10087148, Example 10?
US10087148, Example 10 has a molecular weight of 495.60 g/mol, XLogP of 4.80, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for US10087148, Example 10 is sourced from PubChem (CID 121378086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).