C23H26F3N7O2 — CID 121378330
6-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrazol-4-yl]-4-[1-(1,1,1-trifluoropentan-3-yl)pyrazol-4-yl]pyrazolo[1,5-a]pyrazine (PubChem CID 121378330) has the molecular formula C23H26F3N7O2 and a molecular weight of 489.50 g/mol. Its IUPAC name is 6-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrazol-4-yl]-4-[1-(1,1,1-trifluoropentan-3-yl)pyrazol-4-yl]pyrazolo[1,5-a]pyrazine.
| Compound Name | 6-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrazol-4-yl]-4-[1-(1,1,1-trifluoropentan-3-yl)pyrazol-4-yl]pyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 121378330 |
| Molecular Formula | C23H26F3N7O2 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 6-[1-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]pyrazol-4-yl]-4-[1-(1,1,1-trifluoropentan-3-yl)pyrazol-4-yl]pyrazolo[1,5-a]pyrazine |
| SMILES | CCC(CC(F)(F)F)n1cc(-c2nc(-c3cnn(C[C@@H]4COC(C)(C)O4)c3)cn3nccc23)cn1 |
| InChI | InChI=1S/C23H26F3N7O2/c1-4-17(7-23(24,25)26)32-11-16(9-29-32)21-20-5-6-27-33(20)13-19(30-21)15-8-28-31(10-15)12-18-14-34-22(2,3)35-18/h5-6,8-11,13,17-18H,4,7,12,14H2,1-3H3/t17?,18-/m1/s1 |
| InChIKey | WLSGYOXRMIOHGE-QRWMCTBCSA-N |
| XLogP | 4.51 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |