C26H30F6N4O2 — CID 121379013
4-(dimethylamino)-2-[[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]-2-[[2-(trifluoromethyl)phenyl]methyl]butanamide (PubChem CID 121379013) has the molecular formula C26H30F6N4O2 and a molecular weight of 544.54 g/mol. Its IUPAC name is 4-(dimethylamino)-2-[[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]-2-[[2-(trifluoromethyl)phenyl]methyl]butanamide.
| Compound Name | 4-(dimethylamino)-2-[[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]-2-[[2-(trifluoromethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 121379013 |
| Molecular Formula | C26H30F6N4O2 |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 4-(dimethylamino)-2-[[3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]-2-[[2-(trifluoromethyl)phenyl]methyl]butanamide |
| SMILES | CN(C)CCC(Cc1ccccc1C(F)(F)F)(Nc1cccc2c1CCN(C(=O)C(F)(F)F)CC2)C(N)=O |
| InChI | InChI=1S/C26H30F6N4O2/c1-35(2)15-12-24(22(33)37,16-18-6-3-4-8-20(18)25(27,28)29)34-21-9-5-7-17-10-13-36(14-11-19(17)21)23(38)26(30,31)32/h3-9,34H,10-16H2,1-2H3,(H2,33,37) |
| InChIKey | CDVKKMDHKUZWLU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |