About 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile
6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile (PubChem CID 121379100) has the molecular formula C18H16N4O2
and a molecular weight of 320.35 g/mol. Its IUPAC name is 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile.
Molecular Properties
| Compound Name | 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile |
| PubChem CID | 121379100 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile |
| SMILES | Cn1ncc2c(C#N)cc(-c3cncc4c3COCC4(C)O)cc21 |
| InChI | InChI=1S/C18H16N4O2/c1-18(23)10-24-9-15-13(6-20-8-16(15)18)11-3-12(5-19)14-7-21-22(2)17(14)4-11/h3-4,6-8,23H,9-10H2,1-2H3 |
| InChIKey | UETSHSNMSAJCND-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile?
The IUPAC name of 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile (CID 121379100) is 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile.
What is the SMILES notation for 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile?
The canonical SMILES for 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile is Cn1ncc2c(C#N)cc(-c3cncc4c3COCC4(C)O)cc21.
What is the InChIKey of 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile?
The InChIKey is UETSHSNMSAJCND-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4O2/c1-18(23)10-24-9-15-13(6-20-8-16(15)18)11-3-12(5-19)14-7-21-22(2)17(14)4-11/h3-4,6-8,23H,9-10H2,1-2H3.
What are the key properties of 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile?
6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile has a molecular weight of 320.35 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-hydroxy-4-methyl-1,3-dihydropyrano[4,3-c]pyridin-8-yl)-1-methylindazole-4-carbonitrile is sourced from PubChem (CID 121379100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).