C26H27N3O5 — CID 121379625
2-[2-[[3-[3-(2-amino-2-oxoethyl)phenyl]-5-(2-methoxyethylamino)benzoyl]amino]phenyl]acetic acid (PubChem CID 121379625) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is 2-[2-[[3-[3-(2-amino-2-oxoethyl)phenyl]-5-(2-methoxyethylamino)benzoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[2-[[3-[3-(2-amino-2-oxoethyl)phenyl]-5-(2-methoxyethylamino)benzoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 121379625 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 2-[2-[[3-[3-(2-amino-2-oxoethyl)phenyl]-5-(2-methoxyethylamino)benzoyl]amino]phenyl]acetic acid |
| SMILES | COCCNc1cc(C(=O)Nc2ccccc2CC(=O)O)cc(-c2cccc(CC(N)=O)c2)c1 |
| InChI | InChI=1S/C26H27N3O5/c1-34-10-9-28-22-14-20(18-7-4-5-17(11-18)12-24(27)30)13-21(15-22)26(33)29-23-8-3-2-6-19(23)16-25(31)32/h2-8,11,13-15,28H,9-10,12,16H2,1H3,(H2,27,30)(H,29,33)(H,31,32) |
| InChIKey | JHWSUFIKGXCQGE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|