C24H28F3N5O3 — CID 121379746
(8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[4-(2,2,2-trifluoroethyl)-1,4-oxazepan-7-yl]methanone (PubChem CID 121379746) has the molecular formula C24H28F3N5O3 and a molecular weight of 491.51 g/mol. Its IUPAC name is (8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[4-(2,2,2-trifluoroethyl)-1,4-oxazepan-7-yl]methanone.
| Compound Name | (8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[4-(2,2,2-trifluoroethyl)-1,4-oxazepan-7-yl]methanone |
|---|---|
| PubChem CID | 121379746 |
| Molecular Formula | C24H28F3N5O3 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | (8-morpholin-4-yl-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl)-[4-(2,2,2-trifluoroethyl)-1,4-oxazepan-7-yl]methanone |
| SMILES | O=C(C1CCN(CC(F)(F)F)CCO1)N1Cc2cccnc2Nc2ccc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C24H28F3N5O3/c25-24(26,27)16-30-7-5-21(35-13-8-30)23(33)32-15-17-2-1-6-28-22(17)29-19-4-3-18(14-20(19)32)31-9-11-34-12-10-31/h1-4,6,14,21H,5,7-13,15-16H2,(H,28,29) |
| InChIKey | QINMJTLRKLDGGI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |