C14H23NO5S — CID 121380415
[(3aR,6aS)-2-(3-oxopentanoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl methanesulfonate (PubChem CID 121380415) has the molecular formula C14H23NO5S and a molecular weight of 317.41 g/mol. Its IUPAC name is [(3aR,6aS)-2-(3-oxopentanoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl methanesulfonate.
| Compound Name | [(3aR,6aS)-2-(3-oxopentanoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 121380415 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [(3aR,6aS)-2-(3-oxopentanoyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl methanesulfonate |
| SMILES | CCC(=O)CC(=O)N1C[C@H]2CC(COS(C)(=O)=O)C[C@H]2C1 |
| InChI | InChI=1S/C14H23NO5S/c1-3-13(16)6-14(17)15-7-11-4-10(5-12(11)8-15)9-20-21(2,18)19/h10-12H,3-9H2,1-2H3/t10?,11-,12+ |
| InChIKey | PTYVAZMXEFFQQE-YOGCLGLASA-N |
| XLogP | 0.82 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|