C19H28FNO — CID 121380484
N-[(2S)-2-(2-fluoro-4-methylphenyl)-4-methyl-3-methylidenepentyl]oxan-4-amine (PubChem CID 121380484) has the molecular formula C19H28FNO and a molecular weight of 305.44 g/mol. Its IUPAC name is N-[(2S)-2-(2-fluoro-4-methylphenyl)-4-methyl-3-methylidenepentyl]oxan-4-amine.
| Compound Name | N-[(2S)-2-(2-fluoro-4-methylphenyl)-4-methyl-3-methylidenepentyl]oxan-4-amine |
|---|---|
| PubChem CID | 121380484 |
| Molecular Formula | C19H28FNO |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | N-[(2S)-2-(2-fluoro-4-methylphenyl)-4-methyl-3-methylidenepentyl]oxan-4-amine |
| SMILES | C=C(C(C)C)[C@H](CNC1CCOCC1)c1ccc(C)cc1F |
| InChI | InChI=1S/C19H28FNO/c1-13(2)15(4)18(12-21-16-7-9-22-10-8-16)17-6-5-14(3)11-19(17)20/h5-6,11,13,16,18,21H,4,7-10,12H2,1-3H3/t18-/m0/s1 |
| InChIKey | OVNYPACYFUHOMM-SFHVURJKSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|