C17H23BrF3NO — CID 121380488
3-[[(3S)-3-(4-bromophenyl)-5-methyl-4-methylidenehexyl]amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 121380488) has the molecular formula C17H23BrF3NO and a molecular weight of 394.28 g/mol. Its IUPAC name is 3-[[(3S)-3-(4-bromophenyl)-5-methyl-4-methylidenehexyl]amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[[(3S)-3-(4-bromophenyl)-5-methyl-4-methylidenehexyl]amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 121380488 |
| Molecular Formula | C17H23BrF3NO |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 3-[[(3S)-3-(4-bromophenyl)-5-methyl-4-methylidenehexyl]amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | C=C(C(C)C)[C@H](CCNCC(O)C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H23BrF3NO/c1-11(2)12(3)15(13-4-6-14(18)7-5-13)8-9-22-10-16(23)17(19,20)21/h4-7,11,15-16,22-23H,3,8-10H2,1-2H3/t15-,16?/m0/s1 |
| InChIKey | MHZNXFHWAFQIDH-VYRBHSGPSA-N |
| XLogP | 4.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|