C34H54O6 — CID 121380586
4-[(2E,10E,18E,26E)-28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one (PubChem CID 121380586) has the molecular formula C34H54O6 and a molecular weight of 558.80 g/mol. Its IUPAC name is 4-[(2E,10E,18E,26E)-28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[(2E,10E,18E,26E)-28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 121380586 |
| Molecular Formula | C34H54O6 |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | 4-[(2E,10E,18E,26E)-28-(2-oxo-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(C/C=C/CCCCCC/C=C/CCCCCC/C=C/CCCCCC/C=C/CC2COC(=O)O2)O1 |
| InChI | InChI=1S/C34H54O6/c35-33-37-29-31(39-33)27-25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26-28-32-30-38-34(36)40-32/h7-10,23-26,31-32H,1-6,11-22,27-30H2/b9-7+,10-8+,25-23+,26-24+ |
| InChIKey | BYCMUYWNTMJXHW-OCUQFVIXSA-N |
| XLogP | 10.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|