C30H16N6OS — CID 121380707
2-[[2-(2,2-dicyanoethenyl)-5,12-dimethyl-7-oxo-14-sulfanylidenequinolino[2,3-b]acridin-9-yl]methylidene]propanedinitrile (PubChem CID 121380707) has the molecular formula C30H16N6OS and a molecular weight of 508.57 g/mol. Its IUPAC name is 2-[[2-(2,2-dicyanoethenyl)-5,12-dimethyl-7-oxo-14-sulfanylidenequinolino[2,3-b]acridin-9-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[2-(2,2-dicyanoethenyl)-5,12-dimethyl-7-oxo-14-sulfanylidenequinolino[2,3-b]acridin-9-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 121380707 |
| Molecular Formula | C30H16N6OS |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 2-[[2-(2,2-dicyanoethenyl)-5,12-dimethyl-7-oxo-14-sulfanylidenequinolino[2,3-b]acridin-9-yl]methylidene]propanedinitrile |
| SMILES | Cn1c2ccc(C=C(C#N)C#N)cc2c(=O)c2cc3c(cc21)c(=S)c1cc(C=C(C#N)C#N)ccc1n3C |
| InChI | InChI=1S/C30H16N6OS/c1-35-25-5-3-17(7-19(13-31)14-32)9-21(25)29(37)22-11-28-24(12-27(22)35)30(38)23-10-18(8-20(15-33)16-34)4-6-26(23)36(28)2/h3-12H,1-2H3 |
| InChIKey | FSIAFDLMDYRNQA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 122.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|