About 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one
3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one (PubChem CID 121381799) has the molecular formula C20H16N6OS
and a molecular weight of 388.46 g/mol. Its IUPAC name is 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one.
Molecular Properties
| Compound Name | 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one |
| PubChem CID | 121381799 |
| Molecular Formula | C20H16N6OS |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(CSc2ncnc3nc[nH]c23)n1C1=CC=CCC1 |
| InChI | InChI=1S/C20H16N6OS/c27-20-14-8-4-5-9-15(14)25-16(26(20)13-6-2-1-3-7-13)10-28-19-17-18(22-11-21-17)23-12-24-19/h1-2,4-6,8-9,11-12H,3,7,10H2,(H,21,22,23,24) |
| InChIKey | UPPHQPNVTYPTKC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one?
The IUPAC name of 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one (CID 121381799) is 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one.
What is the SMILES notation for 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one?
The canonical SMILES for 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one is O=c1c2ccccc2nc(CSc2ncnc3nc[nH]c23)n1C1=CC=CCC1.
What is the InChIKey of 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one?
The InChIKey is UPPHQPNVTYPTKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N6OS/c27-20-14-8-4-5-9-15(14)25-16(26(20)13-6-2-1-3-7-13)10-28-19-17-18(22-11-21-17)23-12-24-19/h1-2,4-6,8-9,11-12H,3,7,10H2,(H,21,22,23,24).
What are the key properties of 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one?
3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one has a molecular weight of 388.46 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,3-dien-1-yl-2-(7H-purin-6-ylsulfanylmethyl)quinazolin-4-one is sourced from PubChem (CID 121381799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).