C18H19FIN3OS — CID 121381860
(4aR,6R,9aS)-9a-(2-fluoro-4-iodophenyl)-6-(1,3-oxazol-2-yl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine (PubChem CID 121381860) has the molecular formula C18H19FIN3OS and a molecular weight of 471.34 g/mol. Its IUPAC name is (4aR,6R,9aS)-9a-(2-fluoro-4-iodophenyl)-6-(1,3-oxazol-2-yl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine.
| Compound Name | (4aR,6R,9aS)-9a-(2-fluoro-4-iodophenyl)-6-(1,3-oxazol-2-yl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 121381860 |
| Molecular Formula | C18H19FIN3OS |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | (4aR,6R,9aS)-9a-(2-fluoro-4-iodophenyl)-6-(1,3-oxazol-2-yl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3ccc(I)cc3F)CCC[C@@H](c3ncco3)C[C@H]2CS1 |
| InChI | InChI=1S/C18H19FIN3OS/c19-15-9-13(20)3-4-14(15)18-5-1-2-11(16-22-6-7-24-16)8-12(18)10-25-17(21)23-18/h3-4,6-7,9,11-12H,1-2,5,8,10H2,(H2,21,23)/t11-,12+,18+/m1/s1 |
| InChIKey | GMDCWFDRMFRPIS-SOZUMNATSA-N |
| XLogP | 4.65 |
| TPSA | 64.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|