C36H41FN4O7S — CID 121382171
(2S,4R)-1-[9-[(1R,2S)-2-(cyclopropylsulfonylcarbamoyl)cyclopropyl]nonanoyl]-4-[(2-fluoro-[1]benzofuro[3,2-b]quinolin-11-yl)oxy]pyrrolidine-2-carboxamide (PubChem CID 121382171) has the molecular formula C36H41FN4O7S and a molecular weight of 692.81 g/mol. Its IUPAC name is (2S,4R)-1-[9-[(1R,2S)-2-(cyclopropylsulfonylcarbamoyl)cyclopropyl]nonanoyl]-4-[(2-fluoro-[1]benzofuro[3,2-b]quinolin-11-yl)oxy]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[9-[(1R,2S)-2-(cyclopropylsulfonylcarbamoyl)cyclopropyl]nonanoyl]-4-[(2-fluoro-[1]benzofuro[3,2-b]quinolin-11-yl)oxy]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 121382171 |
| Molecular Formula | C36H41FN4O7S |
| Molecular Weight | 692.81 g/mol |
| Exact Mass | 692.27 |
| IUPAC Name | (2S,4R)-1-[9-[(1R,2S)-2-(cyclopropylsulfonylcarbamoyl)cyclopropyl]nonanoyl]-4-[(2-fluoro-[1]benzofuro[3,2-b]quinolin-11-yl)oxy]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H](Oc2c3cc(F)ccc3nc3c2oc2ccccc23)CN1C(=O)CCCCCCCC[C@@H]1C[C@@H]1C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C36H41FN4O7S/c37-22-13-16-28-27(18-22)33(34-32(39-28)25-10-7-8-11-30(25)48-34)47-23-19-29(35(38)43)41(20-23)31(42)12-6-4-2-1-3-5-9-21-17-26(21)36(44)40-49(45,46)24-14-15-24/h7-8,10-11,13,16,18,21,23-24,26,29H,1-6,9,12,14-15,17,19-20H2,(H2,38,43)(H,40,44)/t21-,23-,26+,29+/m1/s1 |
| InChIKey | AEIRQZYDJHKZKL-OARFPTAASA-N |
| XLogP | 5.47 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.81 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|